C23H28N4O5 — CID 75465482
3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide (PubChem CID 75465482) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide.
| Compound Name | 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 75465482 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
| SMILES | COc1ccc(CCN2C(=O)NC(CCC(=O)NCCc3ccncc3)C2=O)cc1OC |
| InChI | InChI=1S/C23H28N4O5/c1-31-19-5-3-17(15-20(19)32-2)10-14-27-22(29)18(26-23(27)30)4-6-21(28)25-13-9-16-7-11-24-12-8-16/h3,5,7-8,11-12,15,18H,4,6,9-10,13-14H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | QBEWCVBNXBWHGA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|