C20H21ClN4O3 — CID 124861341
3-[(4R)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide (PubChem CID 124861341) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 3-[(4R)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide.
| Compound Name | 3-[(4R)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 124861341 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[(4R)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
| SMILES | O=C(CC[C@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)NCCc1ccncc1 |
| InChI | InChI=1S/C20H21ClN4O3/c21-16-4-2-1-3-15(16)13-25-19(27)17(24-20(25)28)5-6-18(26)23-12-9-14-7-10-22-11-8-14/h1-4,7-8,10-11,17H,5-6,9,12-13H2,(H,23,26)(H,24,28)/t17-/m1/s1 |
| InChIKey | HJTLMQMUHYEDMC-QGZVFWFLSA-N |
| XLogP | 2.29 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|