C16H20ClN3O4 — CID 75490651
3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-hydroxypropyl)propanamide (PubChem CID 75490651) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 75490651 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)NCCCO |
| InChI | InChI=1S/C16H20ClN3O4/c17-12-5-2-1-4-11(12)10-20-15(23)13(19-16(20)24)6-7-14(22)18-8-3-9-21/h1-2,4-5,13,21H,3,6-10H2,(H,18,22)(H,19,24)/t13-/m0/s1 |
| InChIKey | SENIREYKFHYUQO-ZDUSSCGKSA-N |
| XLogP | 1.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|