C23H24ClN3O4 — CID 97489497
(5S)-3-[(2-chlorophenyl)methyl]-5-[3-oxo-3-[(2S)-2-phenylmorpholin-4-yl]propyl]imidazolidine-2,4-dione (PubChem CID 97489497) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is (5S)-3-[(2-chlorophenyl)methyl]-5-[3-oxo-3-[(2S)-2-phenylmorpholin-4-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2-chlorophenyl)methyl]-5-[3-oxo-3-[(2S)-2-phenylmorpholin-4-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97489497 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (5S)-3-[(2-chlorophenyl)methyl]-5-[3-oxo-3-[(2S)-2-phenylmorpholin-4-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C(CC[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)N1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H24ClN3O4/c24-18-9-5-4-8-17(18)14-27-22(29)19(25-23(27)30)10-11-21(28)26-12-13-31-20(15-26)16-6-2-1-3-7-16/h1-9,19-20H,10-15H2,(H,25,30)/t19-,20+/m0/s1 |
| InChIKey | AJEZDHWBAVVFQI-VQTJNVASSA-N |
| XLogP | 3.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|