C22H22ClN3O4 — CID 91638752
(5S)-3-[(2-chlorophenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 91638752) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is (5S)-3-[(2-chlorophenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2-chlorophenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91638752 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (5S)-3-[(2-chlorophenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)N1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H22ClN3O4/c23-17-9-5-4-8-16(17)13-26-21(28)18(24-22(26)29)12-20(27)25-10-11-30-19(14-25)15-6-2-1-3-7-15/h1-9,18-19H,10-14H2,(H,24,29)/t18-,19?/m0/s1 |
| InChIKey | BXKPNTSNIZNCMP-OYKVQYDMSA-N |
| XLogP | 2.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|