C23H25N3O5 — CID 91640441
(5S)-3-[(4-methoxyphenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 91640441) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is (5S)-3-[(4-methoxyphenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(4-methoxyphenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91640441 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (5S)-3-[(4-methoxyphenyl)methyl]-5-[2-oxo-2-(2-phenylmorpholin-4-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CC(=O)N3CCOC(c4ccccc4)C3)C2=O)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-30-18-9-7-16(8-10-18)14-26-22(28)19(24-23(26)29)13-21(27)25-11-12-31-20(15-25)17-5-3-2-4-6-17/h2-10,19-20H,11-15H2,1H3,(H,24,29)/t19-,20?/m0/s1 |
| InChIKey | SZARIVSTNJAPSR-XJDOXCRVSA-N |
| XLogP | 2.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|