C17H20ClN3O5S — CID 97496369
3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 97496369) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 97496369 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 3-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20ClN3O5S/c18-13-4-2-1-3-11(13)9-21-16(23)14(20-17(21)24)5-6-15(22)19-12-7-8-27(25,26)10-12/h1-4,12,14H,5-10H2,(H,19,22)(H,20,24)/t12-,14+/m1/s1 |
| InChIKey | OWBIISJHTFIFMU-OCCSQVGLSA-N |
| XLogP | 0.84 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|