C21H24N4O4 — CID 124862016
3-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 124862016) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | 3-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 124862016 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | COc1ccccc1CN1C(=O)N[C@H](CCC(=O)NCCc2ccccn2)C1=O |
| InChI | InChI=1S/C21H24N4O4/c1-29-18-8-3-2-6-15(18)14-25-20(27)17(24-21(25)28)9-10-19(26)23-13-11-16-7-4-5-12-22-16/h2-8,12,17H,9-11,13-14H2,1H3,(H,23,26)(H,24,28)/t17-/m1/s1 |
| InChIKey | KVQIHPUTSCWTSY-QGZVFWFLSA-N |
| XLogP | 1.65 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|