C23H22N4O3 — CID 124841892
3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 124841892) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | 3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 124841892 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | O=C(CC[C@H]1NC(=O)N(c2cccc3ccccc23)C1=O)NCCc1ccccn1 |
| InChI | InChI=1S/C23H22N4O3/c28-21(25-15-13-17-8-3-4-14-24-17)12-11-19-22(29)27(23(30)26-19)20-10-5-7-16-6-1-2-9-18(16)20/h1-10,14,19H,11-13,15H2,(H,25,28)(H,26,30)/t19-/m1/s1 |
| InChIKey | BGIPPGYWJJQLEO-LJQANCHMSA-N |
| XLogP | 2.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|