C23H28N4O3 — CID 124850987
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 124850987) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 124850987 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)CC[C@@H]1NC(=O)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C23H28N4O3/c1-2-26-14-6-9-17(26)15-24-21(28)13-12-19-22(29)27(23(30)25-19)20-11-5-8-16-7-3-4-10-18(16)20/h3-5,7-8,10-11,17,19H,2,6,9,12-15H2,1H3,(H,24,28)(H,25,30)/t17-,19-/m0/s1 |
| InChIKey | RNEWONJCLMSXPD-HKUYNNGSSA-N |
| XLogP | 2.65 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|