C22H22N4O3S — CID 126418695
N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 126418695) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 126418695 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | Cc1csc(CCNC(=O)CC[C@H]2NC(=O)N(c3cccc4ccccc34)C2=O)n1 |
| InChI | InChI=1S/C22H22N4O3S/c1-14-13-30-20(24-14)11-12-23-19(27)10-9-17-21(28)26(22(29)25-17)18-8-4-6-15-5-2-3-7-16(15)18/h2-8,13,17H,9-12H2,1H3,(H,23,27)(H,25,29)/t17-/m1/s1 |
| InChIKey | WUJZUZJYPVFNOS-QGZVFWFLSA-N |
| XLogP | 3.17 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|