C20H24N4O5S — CID 110205776
N-[2-(dimethylsulfamoyl)ethyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 110205776) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 110205776 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-3-[(4S)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)CC[C@@H]1NC(=O)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C20H24N4O5S/c1-23(2)30(28,29)13-12-21-18(25)11-10-16-19(26)24(20(27)22-16)17-9-5-7-14-6-3-4-8-15(14)17/h3-9,16H,10-13H2,1-2H3,(H,21,25)(H,22,27)/t16-/m0/s1 |
| InChIKey | AAFLTTCPBLUCHP-INIZCTEOSA-N |
| XLogP | 1.05 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|