C15H20N4O4S — CID 135637114
N-[2-(dimethylsulfamoyl)ethyl]-3-(4-oxo-3H-quinazolin-2-yl)propanamide (PubChem CID 135637114) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-3-(4-oxo-3H-quinazolin-2-yl)propanamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
|---|---|
| PubChem CID | 135637114 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)CCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O4S/c1-19(2)24(22,23)10-9-16-14(20)8-7-13-17-12-6-4-3-5-11(12)15(21)18-13/h3-6H,7-10H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | LJKWHVIQPNVEPO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |