C22H23N5O3 — CID 124850117
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 124850117) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 124850117 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[(4R)-1-naphthalen-1-yl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | Cc1n[nH]c(C)c1CNC(=O)CC[C@H]1NC(=O)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C22H23N5O3/c1-13-17(14(2)26-25-13)12-23-20(28)11-10-18-21(29)27(22(30)24-18)19-9-5-7-15-6-3-4-8-16(15)19/h3-9,18H,10-12H2,1-2H3,(H,23,28)(H,24,30)(H,25,26)/t18-/m1/s1 |
| InChIKey | PZTPULAMKOUSOV-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|