C20H22N4O3 — CID 124863789
3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide (PubChem CID 124863789) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide.
| Compound Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 124863789 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)propanamide |
| SMILES | O=C(CC[C@H]1NC(=O)N(Cc2ccccc2)C1=O)NCCc1ccncc1 |
| InChI | InChI=1S/C20H22N4O3/c25-18(22-13-10-15-8-11-21-12-9-15)7-6-17-19(26)24(20(27)23-17)14-16-4-2-1-3-5-16/h1-5,8-9,11-12,17H,6-7,10,13-14H2,(H,22,25)(H,23,27)/t17-/m1/s1 |
| InChIKey | ULGBAYDPHIVIPH-QGZVFWFLSA-N |
| XLogP | 1.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|