C22H25N3O4 — CID 91637016
3-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]propanamide (PubChem CID 91637016) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]propanamide.
| Compound Name | 3-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 91637016 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)N(CCc2ccccc2)C1=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C22H25N3O4/c26-18-8-6-17(7-9-18)12-14-23-20(27)11-10-19-21(28)25(22(29)24-19)15-13-16-4-2-1-3-5-16/h1-9,19,26H,10-15H2,(H,23,27)(H,24,29)/t19-/m0/s1 |
| InChIKey | VLXFVXXXHDTXSA-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|