C20H21N3O4 — CID 91637918
2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide (PubChem CID 91637918) has the molecular formula C20H21N3O4 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide.
| Compound Name | 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 91637918 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccccc2)C1=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H21N3O4/c24-16-8-6-14(7-9-16)10-11-21-18(25)12-17-19(26)23(20(27)22-17)13-15-4-2-1-3-5-15/h1-9,17,24H,10-13H2,(H,21,25)(H,22,27)/t17-/m0/s1 |
| InChIKey | PAEGVZHLBGMESG-KRWDZBQOSA-N |
| XLogP | 1.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|