C24H27N5O3 — CID 124860887
2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]acetamide (PubChem CID 124860887) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 124860887 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1-propan-2-ylbenzimidazol-2-yl)ethyl]acetamide |
| SMILES | CC(C)n1c(CCNC(=O)C[C@H]2NC(=O)N(Cc3ccccc3)C2=O)nc2ccccc21 |
| InChI | InChI=1S/C24H27N5O3/c1-16(2)29-20-11-7-6-10-18(20)26-21(29)12-13-25-22(30)14-19-23(31)28(24(32)27-19)15-17-8-4-3-5-9-17/h3-11,16,19H,12-15H2,1-2H3,(H,25,30)(H,27,32)/t19-/m1/s1 |
| InChIKey | DZVWXAMPLJRZIP-LJQANCHMSA-N |
| XLogP | 2.79 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|