C19H19ClN4O3 — CID 91641162
2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 91641162) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 91641162 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)NCCc1ccncc1 |
| InChI | InChI=1S/C19H19ClN4O3/c20-15-4-2-1-3-14(15)12-24-18(26)16(23-19(24)27)11-17(25)22-10-7-13-5-8-21-9-6-13/h1-6,8-9,16H,7,10-12H2,(H,22,25)(H,23,27)/t16-/m0/s1 |
| InChIKey | FIUXELZLRJLSIE-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|