C20H16ClN5O3S — CID 91638899
2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 91638899) has the molecular formula C20H16ClN5O3S and a molecular weight of 441.90 g/mol. Its IUPAC name is 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 91638899 |
| Molecular Formula | C20H16ClN5O3S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccccc2Cl)C1=O)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C20H16ClN5O3S/c21-14-6-2-1-4-13(14)10-26-18(28)15(24-20(26)29)8-17(27)25-19-23-16(11-30-19)12-5-3-7-22-9-12/h1-7,9,11,15H,8,10H2,(H,24,29)(H,23,25,27)/t15-/m0/s1 |
| InChIKey | KDVGEMIJIKCXPY-HNNXBMFYSA-N |
| XLogP | 3.31 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|