C19H15FN4O3S2 — CID 110209655
2-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 110209655) has the molecular formula C19H15FN4O3S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110209655 |
| Molecular Formula | C19H15FN4O3S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CC1NC(=O)N(Cc2cccc(F)c2)C1=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C19H15FN4O3S2/c20-12-4-1-3-11(7-12)9-24-17(26)13(22-19(24)27)8-16(25)23-18-21-14(10-29-18)15-5-2-6-28-15/h1-7,10,13H,8-9H2,(H,22,27)(H,21,23,25) |
| InChIKey | ZLOUHXOPGKWJDE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|