C15H13FN4O3S — CID 91638917
2-[(4S)-1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 91638917) has the molecular formula C15H13FN4O3S and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(4S)-1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4S)-1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 91638917 |
| Molecular Formula | C15H13FN4O3S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[(4S)-1-[(3-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2cccc(F)c2)C1=O)Nc1nccs1 |
| InChI | InChI=1S/C15H13FN4O3S/c16-10-3-1-2-9(6-10)8-20-13(22)11(18-15(20)23)7-12(21)19-14-17-4-5-24-14/h1-6,11H,7-8H2,(H,18,23)(H,17,19,21)/t11-/m0/s1 |
| InChIKey | FTGZKFLJACQBGU-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|