C18H20N4O5S — CID 71828705
2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 71828705) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 71828705 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CC(=O)Nc3nc(C)cs3)C2=O)cc1OC |
| InChI | InChI=1S/C18H20N4O5S/c1-10-9-28-17(19-10)21-15(23)7-12-16(24)22(18(25)20-12)8-11-4-5-13(26-2)14(6-11)27-3/h4-6,9,12H,7-8H2,1-3H3,(H,20,25)(H,19,21,23)/t12-/m0/s1 |
| InChIKey | PMKCMCIZCZYRSE-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|