C22H22N4O5 — CID 99871300
2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-5-yl)acetamide (PubChem CID 99871300) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-5-yl)acetamide.
| Compound Name | 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 99871300 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-5-yl)acetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CC(=O)Nc3ccc4[nH]ccc4c3)C2=O)cc1OC |
| InChI | InChI=1S/C22H22N4O5/c1-30-18-6-3-13(9-19(18)31-2)12-26-21(28)17(25-22(26)29)11-20(27)24-15-4-5-16-14(10-15)7-8-23-16/h3-10,17,23H,11-12H2,1-2H3,(H,24,27)(H,25,29)/t17-/m1/s1 |
| InChIKey | VURRWVMBQQNAMG-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|