C23H24N4O5 — CID 75531635
3-[1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-4-yl)propanamide (PubChem CID 75531635) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-[1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-4-yl)propanamide.
| Compound Name | 3-[1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-4-yl)propanamide |
|---|---|
| PubChem CID | 75531635 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1H-indol-4-yl)propanamide |
| SMILES | COc1ccc(CN2C(=O)NC(CCC(=O)Nc3cccc4[nH]ccc34)C2=O)cc1OC |
| InChI | InChI=1S/C23H24N4O5/c1-31-19-8-6-14(12-20(19)32-2)13-27-22(29)18(26-23(27)30)7-9-21(28)25-17-5-3-4-16-15(17)10-11-24-16/h3-6,8,10-12,18,24H,7,9,13H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | SWRGPXVKFHQFHT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|