C22H24N4O5 — CID 91638918
N-(5-acetamido-2-methoxyphenyl)-3-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 91638918) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-3-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-3-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 91638918 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-3-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)CC[C@@H]1NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N4O5/c1-14(27)23-16-8-10-19(31-2)18(12-16)24-20(28)11-9-17-21(29)26(22(30)25-17)13-15-6-4-3-5-7-15/h3-8,10,12,17H,9,11,13H2,1-2H3,(H,23,27)(H,24,28)(H,25,30)/t17-/m0/s1 |
| InChIKey | ZEPBLMLIHCJUBZ-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|