C17H17ClN4O3S — CID 91639108
2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide (PubChem CID 91639108) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 91639108 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1nc(NC(=O)C[C@@H]2NC(=O)N(Cc3ccccc3Cl)C2=O)sc1C |
| InChI | InChI=1S/C17H17ClN4O3S/c1-9-10(2)26-16(19-9)21-14(23)7-13-15(24)22(17(25)20-13)8-11-5-3-4-6-12(11)18/h3-6,13H,7-8H2,1-2H3,(H,20,25)(H,19,21,23)/t13-/m0/s1 |
| InChIKey | NRJLOMFLFIFLNL-ZDUSSCGKSA-N |
| XLogP | 2.86 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|