C24H26N4O3 — CID 75357103
3-[2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(2-indol-1-ylethyl)propanamide (PubChem CID 75357103) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-[2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(2-indol-1-ylethyl)propanamide.
| Compound Name | 3-[2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(2-indol-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 75357103 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-[2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(2-indol-1-ylethyl)propanamide |
| SMILES | O=C(CCC1NC(=O)N(CCc2ccccc2)C1=O)NCCn1ccc2ccccc21 |
| InChI | InChI=1S/C24H26N4O3/c29-22(25-14-17-27-15-13-19-8-4-5-9-21(19)27)11-10-20-23(30)28(24(31)26-20)16-12-18-6-2-1-3-7-18/h1-9,13,15,20H,10-12,14,16-17H2,(H,25,29)(H,26,31) |
| InChIKey | GCQKSGMHUPDCGT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|