C18H21N5O3 — CID 124861449
3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]propanamide (PubChem CID 124861449) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]propanamide.
| Compound Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 124861449 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]propanamide |
| SMILES | O=C(CC[C@H]1NC(=O)N(Cc2ccccc2)C1=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C18H21N5O3/c24-16(20-9-8-14-10-19-12-21-14)7-6-15-17(25)23(18(26)22-15)11-13-4-2-1-3-5-13/h1-5,10,12,15H,6-9,11H2,(H,19,21)(H,20,24)(H,22,26)/t15-/m1/s1 |
| InChIKey | HVIRJZOCSQCHLZ-OAHLLOKOSA-N |
| XLogP | 0.97 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|