C18H19N5O5 — CID 51829857
2-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide (PubChem CID 51829857) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 51829857 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C18H19N5O5/c24-16(20-4-3-12-7-19-9-21-12)6-13-17(25)23(18(26)22-13)8-11-1-2-14-15(5-11)28-10-27-14/h1-2,5,7,9,13H,3-4,6,8,10H2,(H,19,21)(H,20,24)(H,22,26)/t13-/m1/s1 |
| InChIKey | QIFAPUBHIVMSAB-CYBMUJFWSA-N |
| XLogP | 0.31 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|