C18H24N4O5 — CID 39349369
2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 39349369) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 39349369 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCNC(=O)C[C@@H]1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C18H24N4O5/c1-21(2)7-3-6-19-16(23)9-13-17(24)22(18(25)20-13)10-12-4-5-14-15(8-12)27-11-26-14/h4-5,8,13H,3,6-7,9-11H2,1-2H3,(H,19,23)(H,20,25)/t13-/m0/s1 |
| InChIKey | RYIIUEAEPJSFGQ-ZDUSSCGKSA-N |
| XLogP | 0.29 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|