C22H30N4O5 — CID 75531892
2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 75531892) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 75531892 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(NC(=O)CC2NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C22H30N4O5/c1-21(2)9-14(10-22(3,4)25-21)23-18(27)8-15-19(28)26(20(29)24-15)11-13-5-6-16-17(7-13)31-12-30-16/h5-7,14-15,25H,8-12H2,1-4H3,(H,23,27)(H,24,29) |
| InChIKey | GKZJFCZSNKWRGI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|