C23H29N3O5 — CID 98226439
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 98226439) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98226439 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2C(=O)C[C@@H]2NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)C1 |
| InChI | InChI=1S/C23H29N3O5/c1-22(2)8-15-9-23(3,11-22)12-26(15)19(27)7-16-20(28)25(21(29)24-16)10-14-4-5-17-18(6-14)31-13-30-17/h4-6,15-16H,7-13H2,1-3H3,(H,24,29)/t15-,16+,23+/m1/s1 |
| InChIKey | BFOBFKLWCPQKMC-SYJLOODJSA-N |
| XLogP | 2.65 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|