C21H25N3O7 — CID 29140144
ethyl 1-[2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]piperidine-4-carboxylate (PubChem CID 29140144) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is ethyl 1-[2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 29140144 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | ethyl 1-[2-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C[C@@H]2NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)CC1 |
| InChI | InChI=1S/C21H25N3O7/c1-2-29-20(27)14-5-7-23(8-6-14)18(25)10-15-19(26)24(21(28)22-15)11-13-3-4-16-17(9-13)31-12-30-16/h3-4,9,14-15H,2,5-8,10-12H2,1H3,(H,22,28)/t15-/m0/s1 |
| InChIKey | MSDCWUVBNATHAS-HNNXBMFYSA-N |
| XLogP | 1.03 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|