C21H23N3O7 — CID 75555753
ethyl 1-[[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]piperidine-4-carboxylate (PubChem CID 75555753) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl 1-[[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75555753 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | ethyl 1-[[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C=C2C(=O)NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)CC1 |
| InChI | InChI=1S/C21H23N3O7/c1-2-29-20(27)14-5-7-23(8-6-14)11-15-18(25)22-21(28)24(19(15)26)10-13-3-4-16-17(9-13)31-12-30-16/h3-4,9,11,14H,2,5-8,10,12H2,1H3,(H,22,25,28) |
| InChIKey | IEMHVAVYGSUDRD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|