C27H25N3O7S — CID 126203881
methyl 2-[3-[(E)-[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126203881) has the molecular formula C27H25N3O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl 2-[3-[(E)-[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(E)-[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126203881 |
| Molecular Formula | C27H25N3O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | methyl 2-[3-[(E)-[1-(1,3-benzodioxol-5-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-n2c(C)cc(/C=C3\C(=O)NC(=O)N(Cc4ccc5c(c4)OCO5)C3=O)c2C)sc(C)c1C |
| InChI | InChI=1S/C27H25N3O7S/c1-13-8-18(15(3)30(13)25-22(26(33)35-5)14(2)16(4)38-25)10-19-23(31)28-27(34)29(24(19)32)11-17-6-7-20-21(9-17)37-12-36-20/h6-10H,11-12H2,1-5H3,(H,28,31,34)/b19-10+ |
| InChIKey | LLTOQEQSNHOQKT-VXLYETTFSA-N |
| XLogP | 3.95 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|