C25H21Cl2N3O4S2 — CID 126211963
methyl 2-[3-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126211963) has the molecular formula C25H21Cl2N3O4S2 and a molecular weight of 562.50 g/mol. Its IUPAC name is methyl 2-[3-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126211963 |
| Molecular Formula | C25H21Cl2N3O4S2 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | methyl 2-[3-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-n2c(C)cc(/C=C3\C(=O)NC(=S)N(c4cccc(Cl)c4Cl)C3=O)c2C)sc(C)c1C |
| InChI | InChI=1S/C25H21Cl2N3O4S2/c1-11-9-15(13(3)29(11)23-19(24(33)34-5)12(2)14(4)36-23)10-16-21(31)28-25(35)30(22(16)32)18-8-6-7-17(26)20(18)27/h6-10H,1-5H3,(H,28,31,35)/b16-10+ |
| InChIKey | JVISFIQJOQJDKZ-MHWRWJLKSA-N |
| XLogP | 5.70 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|