C23H33N3O6 — CID 71831317
3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2,2-dimethyloxan-4-yl)propanamide (PubChem CID 71831317) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2,2-dimethyloxan-4-yl)propanamide.
| Compound Name | 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2,2-dimethyloxan-4-yl)propanamide |
|---|---|
| PubChem CID | 71831317 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 3-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(2,2-dimethyloxan-4-yl)propanamide |
| SMILES | COc1ccc(CCN2C(=O)NC(CCC(=O)NC3CCOC(C)(C)C3)C2=O)cc1OC |
| InChI | InChI=1S/C23H33N3O6/c1-23(2)14-16(10-12-32-23)24-20(27)8-6-17-21(28)26(22(29)25-17)11-9-15-5-7-18(30-3)19(13-15)31-4/h5,7,13,16-17H,6,8-12,14H2,1-4H3,(H,24,27)(H,25,29) |
| InChIKey | HHICWVJKBOVZDE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|