C27H40N4O5 — CID 126418452
N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide (PubChem CID 126418452) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide.
| Compound Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 126418452 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@H](CCC(=O)N(C)C[C@@H]3CCCN4CCCC[C@@H]34)C2=O)cc1OC |
| InChI | InChI=1S/C27H40N4O5/c1-29(18-20-7-6-15-30-14-5-4-8-22(20)30)25(32)12-10-21-26(33)31(27(34)28-21)16-13-19-9-11-23(35-2)24(17-19)36-3/h9,11,17,20-22H,4-8,10,12-16,18H2,1-3H3,(H,28,34)/t20-,21+,22-/m0/s1 |
| InChIKey | PVBCZTCFSFRZCF-BDTNDASRSA-N |
| XLogP | 2.67 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|