C22H31N3O3 — CID 110207967
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,7-dimethoxy-N-methyl-1H-indole-2-carboxamide (PubChem CID 110207967) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,7-dimethoxy-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,7-dimethoxy-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110207967 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,7-dimethoxy-N-methyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc(OC)c2[nH]c(C(=O)N(C)C[C@@H]3CCCN4CCCC[C@H]34)cc12 |
| InChI | InChI=1S/C22H31N3O3/c1-24(14-15-7-6-12-25-11-5-4-8-18(15)25)22(26)17-13-16-19(27-2)9-10-20(28-3)21(16)23-17/h9-10,13,15,18,23H,4-8,11-12,14H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | GTRSZTIXNFKAER-MAUKXSAKSA-N |
| XLogP | 3.52 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |