C18H30N4O — CID 122169759
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-methyl-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 122169759) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-methyl-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-methyl-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 122169759 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-methyl-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N(C)CC2CCCN3CCCCC23)n[nH]1 |
| InChI | InChI=1S/C18H30N4O/c1-13(2)15-11-16(20-19-15)18(23)21(3)12-14-7-6-10-22-9-5-4-8-17(14)22/h11,13-14,17H,4-10,12H2,1-3H3,(H,19,20) |
| InChIKey | YADGTRYSWVNAOK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |