C21H30N4O3 — CID 126418394
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(furan-2-yl)-N-(2-methoxyethyl)-1H-pyrazole-3-carboxamide (PubChem CID 126418394) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(furan-2-yl)-N-(2-methoxyethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(furan-2-yl)-N-(2-methoxyethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126418394 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(furan-2-yl)-N-(2-methoxyethyl)-1H-pyrazole-3-carboxamide |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C21H30N4O3/c1-27-13-11-25(15-16-6-4-10-24-9-3-2-7-19(16)24)21(26)18-14-17(22-23-18)20-8-5-12-28-20/h5,8,12,14,16,19H,2-4,6-7,9-11,13,15H2,1H3,(H,22,23)/t16-,19+/m0/s1 |
| InChIKey | WRVCFCAGGBWLAG-QFBILLFUSA-N |
| XLogP | 3.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |