C24H32ClN3O2S — CID 125430390
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(2-chlorophenyl)-N-(2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 125430390) has the molecular formula C24H32ClN3O2S and a molecular weight of 462.06 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(2-chlorophenyl)-N-(2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(2-chlorophenyl)-N-(2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 125430390 |
| Molecular Formula | C24H32ClN3O2S |
| Molecular Weight | 462.06 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(2-chlorophenyl)-N-(2-methoxyethyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)c1nc(C)sc1-c1ccccc1Cl |
| InChI | InChI=1S/C24H32ClN3O2S/c1-17-26-22(23(31-17)19-9-3-4-10-20(19)25)24(29)28(14-15-30-2)16-18-8-7-13-27-12-6-5-11-21(18)27/h3-4,9-10,18,21H,5-8,11-16H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | KGFZXYXPAZQFLH-GHTZIAJQSA-N |
| XLogP | 5.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |