C25H38N4O2S — CID 163092423
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-5-propan-2-yl-2-pyrrol-1-yl-1,3-thiazole-4-carboxamide (PubChem CID 163092423) has the molecular formula C25H38N4O2S and a molecular weight of 458.67 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-5-propan-2-yl-2-pyrrol-1-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-5-propan-2-yl-2-pyrrol-1-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163092423 |
| Molecular Formula | C25H38N4O2S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-5-propan-2-yl-2-pyrrol-1-yl-1,3-thiazole-4-carboxamide |
| SMILES | COCCCN(CC1CCCN2CCCCC12)C(=O)c1nc(-n2cccc2)sc1C(C)C |
| InChI | InChI=1S/C25H38N4O2S/c1-19(2)23-22(26-25(32-23)28-13-6-7-14-28)24(30)29(16-9-17-31-3)18-20-10-8-15-27-12-5-4-11-21(20)27/h6-7,13-14,19-21H,4-5,8-12,15-18H2,1-3H3 |
| InChIKey | MGZRERXFBFJBBL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|