C25H36N4O3 — CID 137169804
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide (PubChem CID 137169804) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
|---|---|
| PubChem CID | 137169804 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(3-methoxypropyl)-3-(4-oxo-3H-quinazolin-2-yl)propanamide |
| SMILES | COCCCN(CC1CCCN2CCCCC12)C(=O)CCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H36N4O3/c1-32-17-7-16-29(18-19-8-6-15-28-14-5-4-11-22(19)28)24(30)13-12-23-26-21-10-3-2-9-20(21)25(31)27-23/h2-3,9-10,19,22H,4-8,11-18H2,1H3,(H,26,27,31) |
| InChIKey | SAHUXLQJUMGPKJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|