C24H41N3O2 — CID 122169824
(2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-4-methyl-2-pyrrol-1-ylpentanamide (PubChem CID 122169824) has the molecular formula C24H41N3O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-4-methyl-2-pyrrol-1-ylpentanamide.
| Compound Name | (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-4-methyl-2-pyrrol-1-ylpentanamide |
|---|---|
| PubChem CID | 122169824 |
| Molecular Formula | C24H41N3O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | (2R)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-4-methyl-2-pyrrol-1-ylpentanamide |
| SMILES | COCCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)[C@@H](CC(C)C)n1cccc1 |
| InChI | InChI=1S/C24H41N3O2/c1-20(2)18-23(26-13-6-7-14-26)24(28)27(16-9-17-29-3)19-21-10-8-15-25-12-5-4-11-22(21)25/h6-7,13-14,20-23H,4-5,8-12,15-19H2,1-3H3/t21-,22+,23+/m0/s1 |
| InChIKey | DDYLPGPVQJKJDT-YTFSRNRJSA-N |
| XLogP | 4.20 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|