C25H35N3O2S — CID 122169820
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 122169820) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122169820 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-2-methyl-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)c1sc(C)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H35N3O2S/c1-19-26-23(20-10-4-3-5-11-20)24(31-19)25(29)28(16-9-17-30-2)18-21-12-8-15-27-14-7-6-13-22(21)27/h3-5,10-11,21-22H,6-9,12-18H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | VCJUFJHEDNZFJQ-FCHUYYIVSA-N |
| XLogP | 4.86 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|