C29H34N2O4 — CID 162972340
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(2-methoxyethyl)-3-(2-oxochromen-3-yl)benzamide (PubChem CID 162972340) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(2-methoxyethyl)-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(2-methoxyethyl)-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 162972340 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-N-(2-methoxyethyl)-3-(2-oxochromen-3-yl)benzamide |
| SMILES | COCCN(CC1CCCN2CCCCC12)C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C29H34N2O4/c1-34-17-16-31(20-24-11-7-15-30-14-5-4-12-26(24)30)28(32)23-10-6-9-21(18-23)25-19-22-8-2-3-13-27(22)35-29(25)33/h2-3,6,8-10,13,18-19,24,26H,4-5,7,11-12,14-17,20H2,1H3 |
| InChIKey | SIWRLMLNHIFITE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|