C22H21NO4 — CID 171907967
N-[(1S,2R)-2-(hydroxymethyl)cyclopentyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 171907967) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[(1S,2R)-2-(hydroxymethyl)cyclopentyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[(1S,2R)-2-(hydroxymethyl)cyclopentyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 171907967 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(1S,2R)-2-(hydroxymethyl)cyclopentyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(N[C@H]1CCC[C@H]1CO)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H21NO4/c24-13-17-8-4-9-19(17)23-21(25)16-7-3-6-14(11-16)18-12-15-5-1-2-10-20(15)27-22(18)26/h1-3,5-7,10-12,17,19,24H,4,8-9,13H2,(H,23,25)/t17-,19-/m0/s1 |
| InChIKey | SVQIWLZWRUHWCX-HKUYNNGSSA-N |
| XLogP | 3.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|