C22H18N2O5 — CID 171914835
N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 171914835) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 171914835 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(NCCN1C(=O)CCC1=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H18N2O5/c25-19-8-9-20(26)24(19)11-10-23-21(27)16-6-3-5-14(12-16)17-13-15-4-1-2-7-18(15)29-22(17)28/h1-7,12-13H,8-11H2,(H,23,27) |
| InChIKey | XLMLMUXDERRUDH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|